C10H14ClN3O2S — CID 80619069
5-chloro-N-[2-(cyclopropylmethoxy)ethyl]-N-methyl-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80619069) has the molecular formula C10H14ClN3O2S and a molecular weight of 275.76 g/mol. Its IUPAC name is 5-chloro-N-[2-(cyclopropylmethoxy)ethyl]-N-methyl-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(cyclopropylmethoxy)ethyl]-N-methyl-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80619069 |
| Molecular Formula | C10H14ClN3O2S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 5-chloro-N-[2-(cyclopropylmethoxy)ethyl]-N-methyl-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CN(CCOCC1CC1)C(=O)c1nnc(Cl)s1 |
| InChI | InChI=1S/C10H14ClN3O2S/c1-14(4-5-16-6-7-2-3-7)9(15)8-12-13-10(11)17-8/h7H,2-6H2,1H3 |
| InChIKey | FXMWNQHYKDTCFD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|