C13H22N4OS — CID 80619130
N-cyclooctyl-5-(ethylamino)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80619130) has the molecular formula C13H22N4OS and a molecular weight of 282.41 g/mol. Its IUPAC name is N-cyclooctyl-5-(ethylamino)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-cyclooctyl-5-(ethylamino)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80619130 |
| Molecular Formula | C13H22N4OS |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-cyclooctyl-5-(ethylamino)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCNc1nnc(C(=O)NC2CCCCCCC2)s1 |
| InChI | InChI=1S/C13H22N4OS/c1-2-14-13-17-16-12(19-13)11(18)15-10-8-6-4-3-5-7-9-10/h10H,2-9H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | NRJQVHCSVCHPEM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |