About [5-(ethylamino)-1,3,4-thiadiazol-2-yl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone
[5-(ethylamino)-1,3,4-thiadiazol-2-yl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone (PubChem CID 80619246) has the molecular formula C13H21N5O2S
and a molecular weight of 311.41 g/mol. Its IUPAC name is [5-(ethylamino)-1,3,4-thiadiazol-2-yl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone.
Molecular Properties
| Compound Name | [5-(ethylamino)-1,3,4-thiadiazol-2-yl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone |
| PubChem CID | 80619246 |
| Molecular Formula | C13H21N5O2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | [5-(ethylamino)-1,3,4-thiadiazol-2-yl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone |
| SMILES | CCNc1nnc(C(=O)N2CCC(N3CCOCC3)C2)s1 |
| InChI | InChI=1S/C13H21N5O2S/c1-2-14-13-16-15-11(21-13)12(19)18-4-3-10(9-18)17-5-7-20-8-6-17/h10H,2-9H2,1H3,(H,14,16) |
| InChIKey | BHOGERKZUWDSAB-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [5-(ethylamino)-1,3,4-thiadiazol-2-yl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(ethylamino)-1,3,4-thiadiazol-2-yl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone?
The IUPAC name of [5-(ethylamino)-1,3,4-thiadiazol-2-yl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone (CID 80619246) is [5-(ethylamino)-1,3,4-thiadiazol-2-yl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone.
What is the SMILES notation for [5-(ethylamino)-1,3,4-thiadiazol-2-yl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone?
The canonical SMILES for [5-(ethylamino)-1,3,4-thiadiazol-2-yl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone is CCNc1nnc(C(=O)N2CCC(N3CCOCC3)C2)s1.
What is the InChIKey of [5-(ethylamino)-1,3,4-thiadiazol-2-yl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone?
The InChIKey is BHOGERKZUWDSAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N5O2S/c1-2-14-13-16-15-11(21-13)12(19)18-4-3-10(9-18)17-5-7-20-8-6-17/h10H,2-9H2,1H3,(H,14,16).
What are the key properties of [5-(ethylamino)-1,3,4-thiadiazol-2-yl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone?
[5-(ethylamino)-1,3,4-thiadiazol-2-yl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone has a molecular weight of 311.41 g/mol, XLogP of 0.52, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(ethylamino)-1,3,4-thiadiazol-2-yl]-(3-morpholin-4-ylpyrrolidin-1-yl)methanone is sourced from PubChem (CID 80619246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).