C7H7ClF3N3O2S — CID 80619561
5-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80619561) has the molecular formula C7H7ClF3N3O2S and a molecular weight of 289.67 g/mol. Its IUPAC name is 5-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80619561 |
| Molecular Formula | C7H7ClF3N3O2S |
| Molecular Weight | 289.67 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 5-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(NCCOCC(F)(F)F)c1nnc(Cl)s1 |
| InChI | InChI=1S/C7H7ClF3N3O2S/c8-6-14-13-5(17-6)4(15)12-1-2-16-3-7(9,10)11/h1-3H2,(H,12,15) |
| InChIKey | VZLFBLKCFFEENM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.67 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|