About 3-benzyl-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one
3-benzyl-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one (PubChem CID 806209) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-benzyl-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one.
Molecular Properties
| Compound Name | 3-benzyl-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one |
| PubChem CID | 806209 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-benzyl-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one |
| SMILES | CC1(C)CC(=O)c2c(Cc3ccccc3)noc2C1 |
| InChI | InChI=1S/C16H17NO2/c1-16(2)9-13(18)15-12(17-19-14(15)10-16)8-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3 |
| InChIKey | XBJQAOMWBPMIHQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-benzyl-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one?
The IUPAC name of 3-benzyl-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one (CID 806209) is 3-benzyl-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one.
What is the SMILES notation for 3-benzyl-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one?
The canonical SMILES for 3-benzyl-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one is CC1(C)CC(=O)c2c(Cc3ccccc3)noc2C1.
What is the InChIKey of 3-benzyl-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one?
The InChIKey is XBJQAOMWBPMIHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2/c1-16(2)9-13(18)15-12(17-19-14(15)10-16)8-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3.
What are the key properties of 3-benzyl-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one?
3-benzyl-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one has a molecular weight of 255.32 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one is sourced from PubChem (CID 806209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).