C13H25NS — CID 80621651
(3,5-dimethylcyclohexyl)-(thiolan-2-yl)methanamine (PubChem CID 80621651) has the molecular formula C13H25NS and a molecular weight of 227.42 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl)-(thiolan-2-yl)methanamine.
| Compound Name | (3,5-dimethylcyclohexyl)-(thiolan-2-yl)methanamine |
|---|---|
| PubChem CID | 80621651 |
| Molecular Formula | C13H25NS |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (3,5-dimethylcyclohexyl)-(thiolan-2-yl)methanamine |
| SMILES | CC1CC(C)CC(C(N)C2CCCS2)C1 |
| InChI | InChI=1S/C13H25NS/c1-9-6-10(2)8-11(7-9)13(14)12-4-3-5-15-12/h9-13H,3-8,14H2,1-2H3 |
| InChIKey | IAMIXZRUEFDBTB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |