C12H17NOS — CID 80622096
2-pyridin-2-yl-1-(thian-2-yl)ethanol (PubChem CID 80622096) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-pyridin-2-yl-1-(thian-2-yl)ethanol.
| Compound Name | 2-pyridin-2-yl-1-(thian-2-yl)ethanol |
|---|---|
| PubChem CID | 80622096 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-pyridin-2-yl-1-(thian-2-yl)ethanol |
| SMILES | OC(Cc1ccccn1)C1CCCCS1 |
| InChI | InChI=1S/C12H17NOS/c14-11(12-6-2-4-8-15-12)9-10-5-1-3-7-13-10/h1,3,5,7,11-12,14H,2,4,6,8-9H2 |
| InChIKey | VPYWOFIJGMTUBK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |