C9H13F4N3O2S — CID 80624189
2-methoxy-N-[[5-(2,2,3,3-tetrafluoropropoxy)-1,3,4-thiadiazol-2-yl]methyl]ethanamine (PubChem CID 80624189) has the molecular formula C9H13F4N3O2S and a molecular weight of 303.28 g/mol. Its IUPAC name is 2-methoxy-N-[[5-(2,2,3,3-tetrafluoropropoxy)-1,3,4-thiadiazol-2-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[5-(2,2,3,3-tetrafluoropropoxy)-1,3,4-thiadiazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 80624189 |
| Molecular Formula | C9H13F4N3O2S |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-methoxy-N-[[5-(2,2,3,3-tetrafluoropropoxy)-1,3,4-thiadiazol-2-yl]methyl]ethanamine |
| SMILES | COCCNCc1nnc(OCC(F)(F)C(F)F)s1 |
| InChI | InChI=1S/C9H13F4N3O2S/c1-17-3-2-14-4-6-15-16-8(19-6)18-5-9(12,13)7(10)11/h7,14H,2-5H2,1H3 |
| InChIKey | WBZKUPMJHOOPJD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|