C8H11F4N3OS — CID 80624476
N-[[5-(2,2,3,3-tetrafluoropropoxy)-1,3,4-thiadiazol-2-yl]methyl]ethanamine (PubChem CID 80624476) has the molecular formula C8H11F4N3OS and a molecular weight of 273.25 g/mol. Its IUPAC name is N-[[5-(2,2,3,3-tetrafluoropropoxy)-1,3,4-thiadiazol-2-yl]methyl]ethanamine.
| Compound Name | N-[[5-(2,2,3,3-tetrafluoropropoxy)-1,3,4-thiadiazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 80624476 |
| Molecular Formula | C8H11F4N3OS |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | N-[[5-(2,2,3,3-tetrafluoropropoxy)-1,3,4-thiadiazol-2-yl]methyl]ethanamine |
| SMILES | CCNCc1nnc(OCC(F)(F)C(F)F)s1 |
| InChI | InChI=1S/C8H11F4N3OS/c1-2-13-3-5-14-15-7(17-5)16-4-8(11,12)6(9)10/h6,13H,2-4H2,1H3 |
| InChIKey | VAANHMDHRAHFDF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|