C9H11F4N3OS — CID 80624660
N-[[5-(2,2,3,3-tetrafluoropropoxy)-1,3,4-thiadiazol-2-yl]methyl]cyclopropanamine (PubChem CID 80624660) has the molecular formula C9H11F4N3OS and a molecular weight of 285.27 g/mol. Its IUPAC name is N-[[5-(2,2,3,3-tetrafluoropropoxy)-1,3,4-thiadiazol-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(2,2,3,3-tetrafluoropropoxy)-1,3,4-thiadiazol-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 80624660 |
| Molecular Formula | C9H11F4N3OS |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | N-[[5-(2,2,3,3-tetrafluoropropoxy)-1,3,4-thiadiazol-2-yl]methyl]cyclopropanamine |
| SMILES | FC(F)C(F)(F)COc1nnc(CNC2CC2)s1 |
| InChI | InChI=1S/C9H11F4N3OS/c10-7(11)9(12,13)4-17-8-16-15-6(18-8)3-14-5-1-2-5/h5,7,14H,1-4H2 |
| InChIKey | IYDHTAGZHGGHPZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|