C10H11ClN6OS — CID 80624852
5-chloro-N-[1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80624852) has the molecular formula C10H11ClN6OS and a molecular weight of 298.76 g/mol. Its IUPAC name is 5-chloro-N-[1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-chloro-N-[1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80624852 |
| Molecular Formula | C10H11ClN6OS |
| Molecular Weight | 298.76 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 5-chloro-N-[1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CC(NC(=O)c1nnc(Cl)s1)c1nnc2n1CCC2 |
| InChI | InChI=1S/C10H11ClN6OS/c1-5(7-14-13-6-3-2-4-17(6)7)12-8(18)9-15-16-10(11)19-9/h5H,2-4H2,1H3,(H,12,18) |
| InChIKey | PZHJWIRZJRBBLT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.76 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |