About methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]-2-methylpropanoate
methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]-2-methylpropanoate (PubChem CID 80625112) has the molecular formula C8H10ClN3O3S
and a molecular weight of 263.71 g/mol. Its IUPAC name is methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]-2-methylpropanoate.
Molecular Properties
| Compound Name | methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]-2-methylpropanoate |
| PubChem CID | 80625112 |
| Molecular Formula | C8H10ClN3O3S |
| Molecular Weight | 263.71 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)c1nnc(Cl)s1 |
| InChI | InChI=1S/C8H10ClN3O3S/c1-8(2,6(14)15-3)10-4(13)5-11-12-7(9)16-5/h1-3H3,(H,10,13) |
| InChIKey | JLRCXCILTKYFBQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.71 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]-2-methylpropanoate?
The IUPAC name of methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]-2-methylpropanoate (CID 80625112) is methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]-2-methylpropanoate.
What is the SMILES notation for methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]-2-methylpropanoate?
The canonical SMILES for methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]-2-methylpropanoate is COC(=O)C(C)(C)NC(=O)c1nnc(Cl)s1.
What is the InChIKey of methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]-2-methylpropanoate?
The InChIKey is JLRCXCILTKYFBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN3O3S/c1-8(2,6(14)15-3)10-4(13)5-11-12-7(9)16-5/h1-3H3,(H,10,13).
What are the key properties of methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]-2-methylpropanoate?
methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]-2-methylpropanoate has a molecular weight of 263.71 g/mol, XLogP of 0.87, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]-2-methylpropanoate is sourced from PubChem (CID 80625112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).