About 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]phenol
2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]phenol (PubChem CID 80625304) has the molecular formula C9H10N4OS2
and a molecular weight of 254.34 g/mol. Its IUPAC name is 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]phenol.
Molecular Properties
| Compound Name | 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]phenol |
| PubChem CID | 80625304 |
| Molecular Formula | C9H10N4OS2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]phenol |
| SMILES | NNc1nnc(CSc2ccccc2O)s1 |
| InChI | InChI=1S/C9H10N4OS2/c10-11-9-13-12-8(16-9)5-15-7-4-2-1-3-6(7)14/h1-4,14H,5,10H2,(H,11,13) |
| InChIKey | ZYDVTKGDNKRBNJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]phenol?
The IUPAC name of 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]phenol (CID 80625304) is 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]phenol.
What is the SMILES notation for 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]phenol?
The canonical SMILES for 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]phenol is NNc1nnc(CSc2ccccc2O)s1.
What is the InChIKey of 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]phenol?
The InChIKey is ZYDVTKGDNKRBNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4OS2/c10-11-9-13-12-8(16-9)5-15-7-4-2-1-3-6(7)14/h1-4,14H,5,10H2,(H,11,13).
What are the key properties of 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]phenol?
2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]phenol has a molecular weight of 254.34 g/mol, XLogP of 1.82, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]phenol is sourced from PubChem (CID 80625304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).