C12H14N4S2 — CID 80625386
[5-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]hydrazine (PubChem CID 80625386) has the molecular formula C12H14N4S2 and a molecular weight of 278.41 g/mol. Its IUPAC name is [5-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]hydrazine.
| Compound Name | [5-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 80625386 |
| Molecular Formula | C12H14N4S2 |
| Molecular Weight | 278.41 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | [5-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]hydrazine |
| SMILES | NNc1nnc(CSc2ccc3c(c2)CCC3)s1 |
| InChI | InChI=1S/C12H14N4S2/c13-14-12-16-15-11(18-12)7-17-10-5-4-8-2-1-3-9(8)6-10/h4-6H,1-3,7,13H2,(H,14,16) |
| InChIKey | STRGKVPQCDBYDQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|