C11H23NS — CID 80627563
N,3-dimethyl-1-(thian-2-yl)butan-1-amine (PubChem CID 80627563) has the molecular formula C11H23NS and a molecular weight of 201.38 g/mol. Its IUPAC name is N,3-dimethyl-1-(thian-2-yl)butan-1-amine.
| Compound Name | N,3-dimethyl-1-(thian-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 80627563 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | N,3-dimethyl-1-(thian-2-yl)butan-1-amine |
| SMILES | CNC(CC(C)C)C1CCCCS1 |
| InChI | InChI=1S/C11H23NS/c1-9(2)8-10(12-3)11-6-4-5-7-13-11/h9-12H,4-8H2,1-3H3 |
| InChIKey | XANFKVUADYMBDI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |