C14H19BrFNS — CID 80627565
2-(4-bromo-2-fluorophenyl)-N-methyl-1-(thian-2-yl)ethanamine (PubChem CID 80627565) has the molecular formula C14H19BrFNS and a molecular weight of 332.28 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-N-methyl-1-(thian-2-yl)ethanamine.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-N-methyl-1-(thian-2-yl)ethanamine |
|---|---|
| PubChem CID | 80627565 |
| Molecular Formula | C14H19BrFNS |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-N-methyl-1-(thian-2-yl)ethanamine |
| SMILES | CNC(Cc1ccc(Br)cc1F)C1CCCCS1 |
| InChI | InChI=1S/C14H19BrFNS/c1-17-13(14-4-2-3-7-18-14)8-10-5-6-11(15)9-12(10)16/h5-6,9,13-14,17H,2-4,7-8H2,1H3 |
| InChIKey | ZRVFZAHGGVFEBY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |