About 1-[5-(chloromethyl)-3-methyl-2-pyridinyl]-4,4-dimethylazepane
1-[5-(chloromethyl)-3-methyl-2-pyridinyl]-4,4-dimethylazepane (PubChem CID 80629257) has the molecular formula C15H23ClN2
and a molecular weight of 266.82 g/mol. Its IUPAC name is 1-[5-(chloromethyl)-3-methyl-2-pyridinyl]-4,4-dimethylazepane.
Molecular Properties
| Compound Name | 1-[5-(chloromethyl)-3-methyl-2-pyridinyl]-4,4-dimethylazepane |
| PubChem CID | 80629257 |
| Molecular Formula | C15H23ClN2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-[5-(chloromethyl)-3-methyl-2-pyridinyl]-4,4-dimethylazepane |
| SMILES | Cc1cc(CCl)cnc1N1CCCC(C)(C)CC1 |
| InChI | InChI=1S/C15H23ClN2/c1-12-9-13(10-16)11-17-14(12)18-7-4-5-15(2,3)6-8-18/h9,11H,4-8,10H2,1-3H3 |
| InChIKey | FRLOUCJLLHIOCQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(chloromethyl)-3-methyl-2-pyridinyl]-4,4-dimethylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(chloromethyl)-3-methyl-2-pyridinyl]-4,4-dimethylazepane?
The IUPAC name of 1-[5-(chloromethyl)-3-methyl-2-pyridinyl]-4,4-dimethylazepane (CID 80629257) is 1-[5-(chloromethyl)-3-methyl-2-pyridinyl]-4,4-dimethylazepane.
What is the SMILES notation for 1-[5-(chloromethyl)-3-methyl-2-pyridinyl]-4,4-dimethylazepane?
The canonical SMILES for 1-[5-(chloromethyl)-3-methyl-2-pyridinyl]-4,4-dimethylazepane is Cc1cc(CCl)cnc1N1CCCC(C)(C)CC1.
What is the InChIKey of 1-[5-(chloromethyl)-3-methyl-2-pyridinyl]-4,4-dimethylazepane?
The InChIKey is FRLOUCJLLHIOCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23ClN2/c1-12-9-13(10-16)11-17-14(12)18-7-4-5-15(2,3)6-8-18/h9,11H,4-8,10H2,1-3H3.
What are the key properties of 1-[5-(chloromethyl)-3-methyl-2-pyridinyl]-4,4-dimethylazepane?
1-[5-(chloromethyl)-3-methyl-2-pyridinyl]-4,4-dimethylazepane has a molecular weight of 266.82 g/mol, XLogP of 4.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(chloromethyl)-3-methyl-2-pyridinyl]-4,4-dimethylazepane is sourced from PubChem (CID 80629257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).