C12H12N4O2 — CID 80632887
(E)-3-[6-(3,5-dimethyl-1,2,4-triazol-1-yl)-3-pyridinyl]prop-2-enoic acid (PubChem CID 80632887) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is (E)-3-[6-(3,5-dimethyl-1,2,4-triazol-1-yl)-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-(3,5-dimethyl-1,2,4-triazol-1-yl)-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 80632887 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | (E)-3-[6-(3,5-dimethyl-1,2,4-triazol-1-yl)-3-pyridinyl]prop-2-enoic acid |
| SMILES | Cc1nc(C)n(-c2ccc(/C=C/C(=O)O)cn2)n1 |
| InChI | InChI=1S/C12H12N4O2/c1-8-14-9(2)16(15-8)11-5-3-10(7-13-11)4-6-12(17)18/h3-7H,1-2H3,(H,17,18)/b6-4+ |
| InChIKey | HWJVSOFBNUVKSP-GQCTYLIASA-N |
| XLogP | 1.38 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|