C16H23N3S — CID 80634325
5-(2-aminopropyl)-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)pyridin-2-amine (PubChem CID 80634325) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 5-(2-aminopropyl)-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)pyridin-2-amine.
| Compound Name | 5-(2-aminopropyl)-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 80634325 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 5-(2-aminopropyl)-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)pyridin-2-amine |
| SMILES | CC(N)Cc1ccc(N(C)C(C)Cc2cccs2)nc1 |
| InChI | InChI=1S/C16H23N3S/c1-12(17)9-14-6-7-16(18-11-14)19(3)13(2)10-15-5-4-8-20-15/h4-8,11-13H,9-10,17H2,1-3H3 |
| InChIKey | HWNFRXJIFLATLU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |