C14H20N4O — CID 80635605
4-[5-[(cyclopropylamino)methyl]-2-pyridinyl]-1,4-diazepan-2-one (PubChem CID 80635605) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-[5-[(cyclopropylamino)methyl]-2-pyridinyl]-1,4-diazepan-2-one.
| Compound Name | 4-[5-[(cyclopropylamino)methyl]-2-pyridinyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 80635605 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 4-[5-[(cyclopropylamino)methyl]-2-pyridinyl]-1,4-diazepan-2-one |
| SMILES | O=C1CN(c2ccc(CNC3CC3)cn2)CCCN1 |
| InChI | InChI=1S/C14H20N4O/c19-14-10-18(7-1-6-15-14)13-5-2-11(9-17-13)8-16-12-3-4-12/h2,5,9,12,16H,1,3-4,6-8,10H2,(H,15,19) |
| InChIKey | VRDIFXZERASSNN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |