C13H19N5O2 — CID 80635727
2-[(2-amino-2-oxoethyl)-[5-[(cyclopropylamino)methyl]-2-pyridinyl]amino]acetamide (PubChem CID 80635727) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[5-[(cyclopropylamino)methyl]-2-pyridinyl]amino]acetamide.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[5-[(cyclopropylamino)methyl]-2-pyridinyl]amino]acetamide |
|---|---|
| PubChem CID | 80635727 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[5-[(cyclopropylamino)methyl]-2-pyridinyl]amino]acetamide |
| SMILES | NC(=O)CN(CC(N)=O)c1ccc(CNC2CC2)cn1 |
| InChI | InChI=1S/C13H19N5O2/c14-11(19)7-18(8-12(15)20)13-4-1-9(6-17-13)5-16-10-2-3-10/h1,4,6,10,16H,2-3,5,7-8H2,(H2,14,19)(H2,15,20) |
| InChIKey | WZWRKHFMLJKKBN-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |