About N-[2-[4,6-dimethyl-2-(thiolan-2-yl)pyrimidin-5-yl]ethyl]-2-methylpropan-2-amine
N-[2-[4,6-dimethyl-2-(thiolan-2-yl)pyrimidin-5-yl]ethyl]-2-methylpropan-2-amine (PubChem CID 80637395) has the molecular formula C16H27N3S
and a molecular weight of 293.48 g/mol. Its IUPAC name is N-[2-[4,6-dimethyl-2-(thiolan-2-yl)pyrimidin-5-yl]ethyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[2-[4,6-dimethyl-2-(thiolan-2-yl)pyrimidin-5-yl]ethyl]-2-methylpropan-2-amine |
| PubChem CID | 80637395 |
| Molecular Formula | C16H27N3S |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N-[2-[4,6-dimethyl-2-(thiolan-2-yl)pyrimidin-5-yl]ethyl]-2-methylpropan-2-amine |
| SMILES | Cc1nc(C2CCCS2)nc(C)c1CCNC(C)(C)C |
| InChI | InChI=1S/C16H27N3S/c1-11-13(8-9-17-16(3,4)5)12(2)19-15(18-11)14-7-6-10-20-14/h14,17H,6-10H2,1-5H3 |
| InChIKey | TXCFJBDUIHCOAR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-[4,6-dimethyl-2-(thiolan-2-yl)pyrimidin-5-yl]ethyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4,6-dimethyl-2-(thiolan-2-yl)pyrimidin-5-yl]ethyl]-2-methylpropan-2-amine?
The IUPAC name of N-[2-[4,6-dimethyl-2-(thiolan-2-yl)pyrimidin-5-yl]ethyl]-2-methylpropan-2-amine (CID 80637395) is N-[2-[4,6-dimethyl-2-(thiolan-2-yl)pyrimidin-5-yl]ethyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[2-[4,6-dimethyl-2-(thiolan-2-yl)pyrimidin-5-yl]ethyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[2-[4,6-dimethyl-2-(thiolan-2-yl)pyrimidin-5-yl]ethyl]-2-methylpropan-2-amine is Cc1nc(C2CCCS2)nc(C)c1CCNC(C)(C)C.
What is the InChIKey of N-[2-[4,6-dimethyl-2-(thiolan-2-yl)pyrimidin-5-yl]ethyl]-2-methylpropan-2-amine?
The InChIKey is TXCFJBDUIHCOAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3S/c1-11-13(8-9-17-16(3,4)5)12(2)19-15(18-11)14-7-6-10-20-14/h14,17H,6-10H2,1-5H3.
What are the key properties of N-[2-[4,6-dimethyl-2-(thiolan-2-yl)pyrimidin-5-yl]ethyl]-2-methylpropan-2-amine?
N-[2-[4,6-dimethyl-2-(thiolan-2-yl)pyrimidin-5-yl]ethyl]-2-methylpropan-2-amine has a molecular weight of 293.48 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4,6-dimethyl-2-(thiolan-2-yl)pyrimidin-5-yl]ethyl]-2-methylpropan-2-amine is sourced from PubChem (CID 80637395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).