About 5-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde
5-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde (PubChem CID 80638351) has the molecular formula C12H15F3N2O
and a molecular weight of 260.26 g/mol. Its IUPAC name is 5-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde |
| PubChem CID | 80638351 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 5-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde |
| SMILES | CCCN(CC(F)(F)F)c1ncc(C=O)cc1C |
| InChI | InChI=1S/C12H15F3N2O/c1-3-4-17(8-12(13,14)15)11-9(2)5-10(7-18)6-16-11/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | ZUNWGXRBUHNJRE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde?
The IUPAC name of 5-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde (CID 80638351) is 5-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde.
What is the SMILES notation for 5-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde?
The canonical SMILES for 5-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde is CCCN(CC(F)(F)F)c1ncc(C=O)cc1C.
What is the InChIKey of 5-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde?
The InChIKey is ZUNWGXRBUHNJRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3N2O/c1-3-4-17(8-12(13,14)15)11-9(2)5-10(7-18)6-16-11/h5-7H,3-4,8H2,1-2H3.
What are the key properties of 5-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde?
5-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde has a molecular weight of 260.26 g/mol, XLogP of 2.98, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde is sourced from PubChem (CID 80638351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).