C18H33N3 — CID 80638929
5-(2-aminobutyl)-N,N-dibutyl-3-methylpyridin-2-amine (PubChem CID 80638929) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is 5-(2-aminobutyl)-N,N-dibutyl-3-methylpyridin-2-amine.
| Compound Name | 5-(2-aminobutyl)-N,N-dibutyl-3-methylpyridin-2-amine |
|---|---|
| PubChem CID | 80638929 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | 5-(2-aminobutyl)-N,N-dibutyl-3-methylpyridin-2-amine |
| SMILES | CCCCN(CCCC)c1ncc(CC(N)CC)cc1C |
| InChI | InChI=1S/C18H33N3/c1-5-8-10-21(11-9-6-2)18-15(4)12-16(14-20-18)13-17(19)7-3/h12,14,17H,5-11,13,19H2,1-4H3 |
| InChIKey | WUMFOAPBVIIOQV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |