About [5-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanamine
[5-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanamine (PubChem CID 80639950) has the molecular formula C11H13N3S2
and a molecular weight of 251.38 g/mol. Its IUPAC name is [5-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [5-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanamine |
| PubChem CID | 80639950 |
| Molecular Formula | C11H13N3S2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | [5-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanamine |
| SMILES | Cc1csc(Sc2ncc(CN)cc2C)n1 |
| InChI | InChI=1S/C11H13N3S2/c1-7-3-9(4-12)5-13-10(7)16-11-14-8(2)6-15-11/h3,5-6H,4,12H2,1-2H3 |
| InChIKey | CCQXGRIATPZCFY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanamine?
The IUPAC name of [5-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanamine (CID 80639950) is [5-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanamine.
What is the SMILES notation for [5-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanamine?
The canonical SMILES for [5-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanamine is Cc1csc(Sc2ncc(CN)cc2C)n1.
What is the InChIKey of [5-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanamine?
The InChIKey is CCQXGRIATPZCFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3S2/c1-7-3-9(4-12)5-13-10(7)16-11-14-8(2)6-15-11/h3,5-6H,4,12H2,1-2H3.
What are the key properties of [5-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanamine?
[5-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanamine has a molecular weight of 251.38 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanamine is sourced from PubChem (CID 80639950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).