C14H18N2S2 — CID 80640378
2-methyl-N-[(6-thiophen-2-ylsulfanyl-3-pyridinyl)methyl]propan-1-amine (PubChem CID 80640378) has the molecular formula C14H18N2S2 and a molecular weight of 278.45 g/mol. Its IUPAC name is 2-methyl-N-[(6-thiophen-2-ylsulfanyl-3-pyridinyl)methyl]propan-1-amine.
| Compound Name | 2-methyl-N-[(6-thiophen-2-ylsulfanyl-3-pyridinyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 80640378 |
| Molecular Formula | C14H18N2S2 |
| Molecular Weight | 278.45 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-methyl-N-[(6-thiophen-2-ylsulfanyl-3-pyridinyl)methyl]propan-1-amine |
| SMILES | CC(C)CNCc1ccc(Sc2cccs2)nc1 |
| InChI | InChI=1S/C14H18N2S2/c1-11(2)8-15-9-12-5-6-13(16-10-12)18-14-4-3-7-17-14/h3-7,10-11,15H,8-9H2,1-2H3 |
| InChIKey | PMLAAYJTGCSDQO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |