C15H16Cl2N2O — CID 80640652
1-[6-(3,5-dichlorophenoxy)-3-pyridinyl]butan-2-amine (PubChem CID 80640652) has the molecular formula C15H16Cl2N2O and a molecular weight of 311.21 g/mol. Its IUPAC name is 1-[6-(3,5-dichlorophenoxy)-3-pyridinyl]butan-2-amine.
| Compound Name | 1-[6-(3,5-dichlorophenoxy)-3-pyridinyl]butan-2-amine |
|---|---|
| PubChem CID | 80640652 |
| Molecular Formula | C15H16Cl2N2O |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 1-[6-(3,5-dichlorophenoxy)-3-pyridinyl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(Oc2cc(Cl)cc(Cl)c2)nc1 |
| InChI | InChI=1S/C15H16Cl2N2O/c1-2-13(18)5-10-3-4-15(19-9-10)20-14-7-11(16)6-12(17)8-14/h3-4,6-9,13H,2,5,18H2,1H3 |
| InChIKey | XRPIRJGOUWABRP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |