About 1-cyclopentylpiperazine
1-cyclopentylpiperazine (PubChem CID 806421) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 1-cyclopentylpiperazine.
Molecular Properties
| Compound Name | 1-cyclopentylpiperazine |
| PubChem CID | 806421 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1-cyclopentylpiperazine |
| SMILES | C1CCC(N2CCNCC2)C1 |
| InChI | InChI=1S/C9H18N2/c1-2-4-9(3-1)11-7-5-10-6-8-11/h9-10H,1-8H2 |
| InChIKey | PVMCQBPJKPMOKM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopentylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentylpiperazine?
The IUPAC name of 1-cyclopentylpiperazine (CID 806421) is 1-cyclopentylpiperazine.
What is the SMILES notation for 1-cyclopentylpiperazine?
The canonical SMILES for 1-cyclopentylpiperazine is C1CCC(N2CCNCC2)C1.
What is the InChIKey of 1-cyclopentylpiperazine?
The InChIKey is PVMCQBPJKPMOKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-2-4-9(3-1)11-7-5-10-6-8-11/h9-10H,1-8H2.
What are the key properties of 1-cyclopentylpiperazine?
1-cyclopentylpiperazine has a molecular weight of 154.26 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentylpiperazine is sourced from PubChem (CID 806421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).