C12H16FN5O2S — CID 80642560
5-amino-2-fluoro-N,3-dimethyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzenesulfonamide (PubChem CID 80642560) has the molecular formula C12H16FN5O2S and a molecular weight of 313.36 g/mol. Its IUPAC name is 5-amino-2-fluoro-N,3-dimethyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzenesulfonamide.
| Compound Name | 5-amino-2-fluoro-N,3-dimethyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 80642560 |
| Molecular Formula | C12H16FN5O2S |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 5-amino-2-fluoro-N,3-dimethyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzenesulfonamide |
| SMILES | Cc1nc(CN(C)S(=O)(=O)c2cc(N)cc(C)c2F)n[nH]1 |
| InChI | InChI=1S/C12H16FN5O2S/c1-7-4-9(14)5-10(12(7)13)21(19,20)18(3)6-11-15-8(2)16-17-11/h4-5H,6,14H2,1-3H3,(H,15,16,17) |
| InChIKey | OJHQTCIRPVHHAV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|