About 2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-fluorobenzonitrile
2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-fluorobenzonitrile (PubChem CID 80643051) has the molecular formula C13H8FN3O3
and a molecular weight of 273.22 g/mol. Its IUPAC name is 2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-fluorobenzonitrile.
Molecular Properties
| Compound Name | 2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-fluorobenzonitrile |
| PubChem CID | 80643051 |
| Molecular Formula | C13H8FN3O3 |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-fluorobenzonitrile |
| SMILES | CC(=O)c1c[nH]c(=O)n(-c2cccc(F)c2C#N)c1=O |
| InChI | InChI=1S/C13H8FN3O3/c1-7(18)9-6-16-13(20)17(12(9)19)11-4-2-3-10(14)8(11)5-15/h2-4,6H,1H3,(H,16,20) |
| InChIKey | XHCZPGIGPROJHF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-fluorobenzonitrile?
The IUPAC name of 2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-fluorobenzonitrile (CID 80643051) is 2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-fluorobenzonitrile.
What is the SMILES notation for 2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-fluorobenzonitrile?
The canonical SMILES for 2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-fluorobenzonitrile is CC(=O)c1c[nH]c(=O)n(-c2cccc(F)c2C#N)c1=O.
What is the InChIKey of 2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-fluorobenzonitrile?
The InChIKey is XHCZPGIGPROJHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8FN3O3/c1-7(18)9-6-16-13(20)17(12(9)19)11-4-2-3-10(14)8(11)5-15/h2-4,6H,1H3,(H,16,20).
What are the key properties of 2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-fluorobenzonitrile?
2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-fluorobenzonitrile has a molecular weight of 273.22 g/mol, XLogP of 0.74, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-fluorobenzonitrile is sourced from PubChem (CID 80643051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).