About 5-acetyl-3-(3,4-difluorophenyl)-1H-pyrimidine-2,4-dione
5-acetyl-3-(3,4-difluorophenyl)-1H-pyrimidine-2,4-dione (PubChem CID 80643335) has the molecular formula C12H8F2N2O3
and a molecular weight of 266.20 g/mol. Its IUPAC name is 5-acetyl-3-(3,4-difluorophenyl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-acetyl-3-(3,4-difluorophenyl)-1H-pyrimidine-2,4-dione |
| PubChem CID | 80643335 |
| Molecular Formula | C12H8F2N2O3 |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 5-acetyl-3-(3,4-difluorophenyl)-1H-pyrimidine-2,4-dione |
| SMILES | CC(=O)c1c[nH]c(=O)n(-c2ccc(F)c(F)c2)c1=O |
| InChI | InChI=1S/C12H8F2N2O3/c1-6(17)8-5-15-12(19)16(11(8)18)7-2-3-9(13)10(14)4-7/h2-5H,1H3,(H,15,19) |
| InChIKey | BCCBDLKQKJSMDL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-acetyl-3-(3,4-difluorophenyl)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-3-(3,4-difluorophenyl)-1H-pyrimidine-2,4-dione?
The IUPAC name of 5-acetyl-3-(3,4-difluorophenyl)-1H-pyrimidine-2,4-dione (CID 80643335) is 5-acetyl-3-(3,4-difluorophenyl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 5-acetyl-3-(3,4-difluorophenyl)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 5-acetyl-3-(3,4-difluorophenyl)-1H-pyrimidine-2,4-dione is CC(=O)c1c[nH]c(=O)n(-c2ccc(F)c(F)c2)c1=O.
What is the InChIKey of 5-acetyl-3-(3,4-difluorophenyl)-1H-pyrimidine-2,4-dione?
The InChIKey is BCCBDLKQKJSMDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F2N2O3/c1-6(17)8-5-15-12(19)16(11(8)18)7-2-3-9(13)10(14)4-7/h2-5H,1H3,(H,15,19).
What are the key properties of 5-acetyl-3-(3,4-difluorophenyl)-1H-pyrimidine-2,4-dione?
5-acetyl-3-(3,4-difluorophenyl)-1H-pyrimidine-2,4-dione has a molecular weight of 266.20 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-3-(3,4-difluorophenyl)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 80643335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).