About N-[2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]methanesulfonamide
N-[2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]methanesulfonamide (PubChem CID 80643768) has the molecular formula C9H13N3O5S
and a molecular weight of 275.29 g/mol. Its IUPAC name is N-[2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]methanesulfonamide |
| PubChem CID | 80643768 |
| Molecular Formula | C9H13N3O5S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | N-[2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]methanesulfonamide |
| SMILES | CC(=O)c1c[nH]c(=O)n(CCNS(C)(=O)=O)c1=O |
| InChI | InChI=1S/C9H13N3O5S/c1-6(13)7-5-10-9(15)12(8(7)14)4-3-11-18(2,16)17/h5,11H,3-4H2,1-2H3,(H,10,15) |
| InChIKey | OLBZEFDPRVKRHL-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]methanesulfonamide?
The IUPAC name of N-[2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]methanesulfonamide (CID 80643768) is N-[2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]methanesulfonamide.
What is the SMILES notation for N-[2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]methanesulfonamide?
The canonical SMILES for N-[2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]methanesulfonamide is CC(=O)c1c[nH]c(=O)n(CCNS(C)(=O)=O)c1=O.
What is the InChIKey of N-[2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]methanesulfonamide?
The InChIKey is OLBZEFDPRVKRHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O5S/c1-6(13)7-5-10-9(15)12(8(7)14)4-3-11-18(2,16)17/h5,11H,3-4H2,1-2H3,(H,10,15).
What are the key properties of N-[2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]methanesulfonamide?
N-[2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]methanesulfonamide has a molecular weight of 275.29 g/mol, XLogP of -1.71, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(5-acetyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]methanesulfonamide is sourced from PubChem (CID 80643768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).