About 2-[6-(1,2,4-thiadiazol-5-ylsulfanyl)-3-pyridinyl]ethanamine
2-[6-(1,2,4-thiadiazol-5-ylsulfanyl)-3-pyridinyl]ethanamine (PubChem CID 80644339) has the molecular formula C9H10N4S2
and a molecular weight of 238.34 g/mol. Its IUPAC name is 2-[6-(1,2,4-thiadiazol-5-ylsulfanyl)-3-pyridinyl]ethanamine.
Molecular Properties
| Compound Name | 2-[6-(1,2,4-thiadiazol-5-ylsulfanyl)-3-pyridinyl]ethanamine |
| PubChem CID | 80644339 |
| Molecular Formula | C9H10N4S2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2-[6-(1,2,4-thiadiazol-5-ylsulfanyl)-3-pyridinyl]ethanamine |
| SMILES | NCCc1ccc(Sc2ncns2)nc1 |
| InChI | InChI=1S/C9H10N4S2/c10-4-3-7-1-2-8(11-5-7)14-9-12-6-13-15-9/h1-2,5-6H,3-4,10H2 |
| InChIKey | XIMKBZITBBQUQR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[6-(1,2,4-thiadiazol-5-ylsulfanyl)-3-pyridinyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(1,2,4-thiadiazol-5-ylsulfanyl)-3-pyridinyl]ethanamine?
The IUPAC name of 2-[6-(1,2,4-thiadiazol-5-ylsulfanyl)-3-pyridinyl]ethanamine (CID 80644339) is 2-[6-(1,2,4-thiadiazol-5-ylsulfanyl)-3-pyridinyl]ethanamine.
What is the SMILES notation for 2-[6-(1,2,4-thiadiazol-5-ylsulfanyl)-3-pyridinyl]ethanamine?
The canonical SMILES for 2-[6-(1,2,4-thiadiazol-5-ylsulfanyl)-3-pyridinyl]ethanamine is NCCc1ccc(Sc2ncns2)nc1.
What is the InChIKey of 2-[6-(1,2,4-thiadiazol-5-ylsulfanyl)-3-pyridinyl]ethanamine?
The InChIKey is XIMKBZITBBQUQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4S2/c10-4-3-7-1-2-8(11-5-7)14-9-12-6-13-15-9/h1-2,5-6H,3-4,10H2.
What are the key properties of 2-[6-(1,2,4-thiadiazol-5-ylsulfanyl)-3-pyridinyl]ethanamine?
2-[6-(1,2,4-thiadiazol-5-ylsulfanyl)-3-pyridinyl]ethanamine has a molecular weight of 238.34 g/mol, XLogP of 1.59, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(1,2,4-thiadiazol-5-ylsulfanyl)-3-pyridinyl]ethanamine is sourced from PubChem (CID 80644339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).