About N-(2,3-dihydro-1H-indol-7-ylmethyl)-2,2-diethoxyethanamine
N-(2,3-dihydro-1H-indol-7-ylmethyl)-2,2-diethoxyethanamine (PubChem CID 80645613) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-7-ylmethyl)-2,2-diethoxyethanamine.
Molecular Properties
| Compound Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-2,2-diethoxyethanamine |
| PubChem CID | 80645613 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-2,2-diethoxyethanamine |
| SMILES | CCOC(CNCc1cccc2c1NCC2)OCC |
| InChI | InChI=1S/C15H24N2O2/c1-3-18-14(19-4-2)11-16-10-13-7-5-6-12-8-9-17-15(12)13/h5-7,14,16-17H,3-4,8-11H2,1-2H3 |
| InChIKey | RNHWMQBHWWAONZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(2,3-dihydro-1H-indol-7-ylmethyl)-2,2-diethoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydro-1H-indol-7-ylmethyl)-2,2-diethoxyethanamine?
The IUPAC name of N-(2,3-dihydro-1H-indol-7-ylmethyl)-2,2-diethoxyethanamine (CID 80645613) is N-(2,3-dihydro-1H-indol-7-ylmethyl)-2,2-diethoxyethanamine.
What is the SMILES notation for N-(2,3-dihydro-1H-indol-7-ylmethyl)-2,2-diethoxyethanamine?
The canonical SMILES for N-(2,3-dihydro-1H-indol-7-ylmethyl)-2,2-diethoxyethanamine is CCOC(CNCc1cccc2c1NCC2)OCC.
What is the InChIKey of N-(2,3-dihydro-1H-indol-7-ylmethyl)-2,2-diethoxyethanamine?
The InChIKey is RNHWMQBHWWAONZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2/c1-3-18-14(19-4-2)11-16-10-13-7-5-6-12-8-9-17-15(12)13/h5-7,14,16-17H,3-4,8-11H2,1-2H3.
What are the key properties of N-(2,3-dihydro-1H-indol-7-ylmethyl)-2,2-diethoxyethanamine?
N-(2,3-dihydro-1H-indol-7-ylmethyl)-2,2-diethoxyethanamine has a molecular weight of 264.37 g/mol, XLogP of 2.14, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydro-1H-indol-7-ylmethyl)-2,2-diethoxyethanamine is sourced from PubChem (CID 80645613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).