C12H11ClFN3O2S — CID 80645770
5-amino-N-(2-chloro-3-pyridinyl)-2-fluoro-3-methylbenzenesulfonamide (PubChem CID 80645770) has the molecular formula C12H11ClFN3O2S and a molecular weight of 315.76 g/mol. Its IUPAC name is 5-amino-N-(2-chloro-3-pyridinyl)-2-fluoro-3-methylbenzenesulfonamide.
| Compound Name | 5-amino-N-(2-chloro-3-pyridinyl)-2-fluoro-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 80645770 |
| Molecular Formula | C12H11ClFN3O2S |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 5-amino-N-(2-chloro-3-pyridinyl)-2-fluoro-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(N)cc(S(=O)(=O)Nc2cccnc2Cl)c1F |
| InChI | InChI=1S/C12H11ClFN3O2S/c1-7-5-8(15)6-10(11(7)14)20(18,19)17-9-3-2-4-16-12(9)13/h2-6,17H,15H2,1H3 |
| InChIKey | PXBHRVHTOMMGSL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|