About 5-chloro-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole
5-chloro-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole (PubChem CID 80646470) has the molecular formula C8H8ClN3O
and a molecular weight of 197.62 g/mol. Its IUPAC name is 5-chloro-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-chloro-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole |
| PubChem CID | 80646470 |
| Molecular Formula | C8H8ClN3O |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 5-chloro-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole |
| SMILES | Cc1c(-c2cc(Cl)on2)cnn1C |
| InChI | InChI=1S/C8H8ClN3O/c1-5-6(4-10-12(5)2)7-3-8(9)13-11-7/h3-4H,1-2H3 |
| InChIKey | MRUVDOBZVJASKZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole?
The IUPAC name of 5-chloro-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole (CID 80646470) is 5-chloro-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole.
What is the SMILES notation for 5-chloro-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole?
The canonical SMILES for 5-chloro-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole is Cc1c(-c2cc(Cl)on2)cnn1C.
What is the InChIKey of 5-chloro-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole?
The InChIKey is MRUVDOBZVJASKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3O/c1-5-6(4-10-12(5)2)7-3-8(9)13-11-7/h3-4H,1-2H3.
What are the key properties of 5-chloro-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole?
5-chloro-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole has a molecular weight of 197.62 g/mol, XLogP of 2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole is sourced from PubChem (CID 80646470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).