C13H14ClN3 — CID 80646586
6-N-[1-(3-chlorophenyl)ethyl]pyridine-2,6-diamine (PubChem CID 80646586) has the molecular formula C13H14ClN3 and a molecular weight of 247.73 g/mol. Its IUPAC name is 6-N-[1-(3-chlorophenyl)ethyl]pyridine-2,6-diamine.
| Compound Name | 6-N-[1-(3-chlorophenyl)ethyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80646586 |
| Molecular Formula | C13H14ClN3 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 6-N-[1-(3-chlorophenyl)ethyl]pyridine-2,6-diamine |
| SMILES | CC(Nc1cccc(N)n1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H14ClN3/c1-9(10-4-2-5-11(14)8-10)16-13-7-3-6-12(15)17-13/h2-9H,1H3,(H3,15,16,17) |
| InChIKey | XNBAVWMUTGBBCJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |