About 3-(6-aminopyrazin-2-yl)sulfanylpropane-1,2-diol
3-(6-aminopyrazin-2-yl)sulfanylpropane-1,2-diol (PubChem CID 80646805) has the molecular formula C7H11N3O2S
and a molecular weight of 201.25 g/mol. Its IUPAC name is 3-(6-aminopyrazin-2-yl)sulfanylpropane-1,2-diol.
Molecular Properties
| Compound Name | 3-(6-aminopyrazin-2-yl)sulfanylpropane-1,2-diol |
| PubChem CID | 80646805 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 3-(6-aminopyrazin-2-yl)sulfanylpropane-1,2-diol |
| SMILES | Nc1cncc(SCC(O)CO)n1 |
| InChI | InChI=1S/C7H11N3O2S/c8-6-1-9-2-7(10-6)13-4-5(12)3-11/h1-2,5,11-12H,3-4H2,(H2,8,10) |
| InChIKey | CANHKPBWNVVKRW-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(6-aminopyrazin-2-yl)sulfanylpropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-aminopyrazin-2-yl)sulfanylpropane-1,2-diol?
The IUPAC name of 3-(6-aminopyrazin-2-yl)sulfanylpropane-1,2-diol (CID 80646805) is 3-(6-aminopyrazin-2-yl)sulfanylpropane-1,2-diol.
What is the SMILES notation for 3-(6-aminopyrazin-2-yl)sulfanylpropane-1,2-diol?
The canonical SMILES for 3-(6-aminopyrazin-2-yl)sulfanylpropane-1,2-diol is Nc1cncc(SCC(O)CO)n1.
What is the InChIKey of 3-(6-aminopyrazin-2-yl)sulfanylpropane-1,2-diol?
The InChIKey is CANHKPBWNVVKRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2S/c8-6-1-9-2-7(10-6)13-4-5(12)3-11/h1-2,5,11-12H,3-4H2,(H2,8,10).
What are the key properties of 3-(6-aminopyrazin-2-yl)sulfanylpropane-1,2-diol?
3-(6-aminopyrazin-2-yl)sulfanylpropane-1,2-diol has a molecular weight of 201.25 g/mol, XLogP of -0.50, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-aminopyrazin-2-yl)sulfanylpropane-1,2-diol is sourced from PubChem (CID 80646805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).