About 6-(5,6-dimethylbenzimidazol-1-yl)pyrazin-2-amine
6-(5,6-dimethylbenzimidazol-1-yl)pyrazin-2-amine (PubChem CID 80647713) has the molecular formula C13H13N5
and a molecular weight of 239.28 g/mol. Its IUPAC name is 6-(5,6-dimethylbenzimidazol-1-yl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 6-(5,6-dimethylbenzimidazol-1-yl)pyrazin-2-amine |
| PubChem CID | 80647713 |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 6-(5,6-dimethylbenzimidazol-1-yl)pyrazin-2-amine |
| SMILES | Cc1cc2ncn(-c3cncc(N)n3)c2cc1C |
| InChI | InChI=1S/C13H13N5/c1-8-3-10-11(4-9(8)2)18(7-16-10)13-6-15-5-12(14)17-13/h3-7H,1-2H3,(H2,14,17) |
| InChIKey | WCERRBKLPOEMBB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(5,6-dimethylbenzimidazol-1-yl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5,6-dimethylbenzimidazol-1-yl)pyrazin-2-amine?
The IUPAC name of 6-(5,6-dimethylbenzimidazol-1-yl)pyrazin-2-amine (CID 80647713) is 6-(5,6-dimethylbenzimidazol-1-yl)pyrazin-2-amine.
What is the SMILES notation for 6-(5,6-dimethylbenzimidazol-1-yl)pyrazin-2-amine?
The canonical SMILES for 6-(5,6-dimethylbenzimidazol-1-yl)pyrazin-2-amine is Cc1cc2ncn(-c3cncc(N)n3)c2cc1C.
What is the InChIKey of 6-(5,6-dimethylbenzimidazol-1-yl)pyrazin-2-amine?
The InChIKey is WCERRBKLPOEMBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N5/c1-8-3-10-11(4-9(8)2)18(7-16-10)13-6-15-5-12(14)17-13/h3-7H,1-2H3,(H2,14,17).
What are the key properties of 6-(5,6-dimethylbenzimidazol-1-yl)pyrazin-2-amine?
6-(5,6-dimethylbenzimidazol-1-yl)pyrazin-2-amine has a molecular weight of 239.28 g/mol, XLogP of 2.01, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5,6-dimethylbenzimidazol-1-yl)pyrazin-2-amine is sourced from PubChem (CID 80647713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).