C13H22N4 — CID 80647967
6-N-(2-methyl-3-pyrrolidin-1-ylpropyl)pyridine-2,6-diamine (PubChem CID 80647967) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is 6-N-(2-methyl-3-pyrrolidin-1-ylpropyl)pyridine-2,6-diamine.
| Compound Name | 6-N-(2-methyl-3-pyrrolidin-1-ylpropyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80647967 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 6-N-(2-methyl-3-pyrrolidin-1-ylpropyl)pyridine-2,6-diamine |
| SMILES | CC(CNc1cccc(N)n1)CN1CCCC1 |
| InChI | InChI=1S/C13H22N4/c1-11(10-17-7-2-3-8-17)9-15-13-6-4-5-12(14)16-13/h4-6,11H,2-3,7-10H2,1H3,(H3,14,15,16) |
| InChIKey | VIHGVKISOGLCHN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |