C18H22N2O — CID 80648522
N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)-4,5,6,7-tetrahydro-1-benzofuran-4-amine (PubChem CID 80648522) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)-4,5,6,7-tetrahydro-1-benzofuran-4-amine.
| Compound Name | N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)-4,5,6,7-tetrahydro-1-benzofuran-4-amine |
|---|---|
| PubChem CID | 80648522 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)-4,5,6,7-tetrahydro-1-benzofuran-4-amine |
| SMILES | c1cc2c(c(CNC3CCCc4occc43)c1)NCCC2 |
| InChI | InChI=1S/C18H22N2O/c1-4-13-6-3-10-19-18(13)14(5-1)12-20-16-7-2-8-17-15(16)9-11-21-17/h1,4-5,9,11,16,19-20H,2-3,6-8,10,12H2 |
| InChIKey | CELVESVZFXFQEW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |