About 3-(2,3-dihydro-1H-indol-7-ylmethylamino)-N,N-dimethylpropanamide
3-(2,3-dihydro-1H-indol-7-ylmethylamino)-N,N-dimethylpropanamide (PubChem CID 80649036) has the molecular formula C14H21N3O
and a molecular weight of 247.34 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-indol-7-ylmethylamino)-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-(2,3-dihydro-1H-indol-7-ylmethylamino)-N,N-dimethylpropanamide |
| PubChem CID | 80649036 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 3-(2,3-dihydro-1H-indol-7-ylmethylamino)-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCNCc1cccc2c1NCC2 |
| InChI | InChI=1S/C14H21N3O/c1-17(2)13(18)7-8-15-10-12-5-3-4-11-6-9-16-14(11)12/h3-5,15-16H,6-10H2,1-2H3 |
| InChIKey | XOJLYAGHGFWLNG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3-dihydro-1H-indol-7-ylmethylamino)-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydro-1H-indol-7-ylmethylamino)-N,N-dimethylpropanamide?
The IUPAC name of 3-(2,3-dihydro-1H-indol-7-ylmethylamino)-N,N-dimethylpropanamide (CID 80649036) is 3-(2,3-dihydro-1H-indol-7-ylmethylamino)-N,N-dimethylpropanamide.
What is the SMILES notation for 3-(2,3-dihydro-1H-indol-7-ylmethylamino)-N,N-dimethylpropanamide?
The canonical SMILES for 3-(2,3-dihydro-1H-indol-7-ylmethylamino)-N,N-dimethylpropanamide is CN(C)C(=O)CCNCc1cccc2c1NCC2.
What is the InChIKey of 3-(2,3-dihydro-1H-indol-7-ylmethylamino)-N,N-dimethylpropanamide?
The InChIKey is XOJLYAGHGFWLNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O/c1-17(2)13(18)7-8-15-10-12-5-3-4-11-6-9-16-14(11)12/h3-5,15-16H,6-10H2,1-2H3.
What are the key properties of 3-(2,3-dihydro-1H-indol-7-ylmethylamino)-N,N-dimethylpropanamide?
3-(2,3-dihydro-1H-indol-7-ylmethylamino)-N,N-dimethylpropanamide has a molecular weight of 247.34 g/mol, XLogP of 1.22, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1H-indol-7-ylmethylamino)-N,N-dimethylpropanamide is sourced from PubChem (CID 80649036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).