C15H23N3 — CID 80649056
N'-cyclopropyl-N-(2,3-dihydro-1H-indol-7-ylmethyl)-N'-methylethane-1,2-diamine (PubChem CID 80649056) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is N'-cyclopropyl-N-(2,3-dihydro-1H-indol-7-ylmethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-cyclopropyl-N-(2,3-dihydro-1H-indol-7-ylmethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 80649056 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | N'-cyclopropyl-N-(2,3-dihydro-1H-indol-7-ylmethyl)-N'-methylethane-1,2-diamine |
| SMILES | CN(CCNCc1cccc2c1NCC2)C1CC1 |
| InChI | InChI=1S/C15H23N3/c1-18(14-5-6-14)10-9-16-11-13-4-2-3-12-7-8-17-15(12)13/h2-4,14,16-17H,5-11H2,1H3 |
| InChIKey | JCDXIQRPCFYMOC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|