C15H24N2O — CID 80649718
N-(2,3-dihydro-1H-indol-7-ylmethyl)-1-methoxypentan-2-amine (PubChem CID 80649718) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-7-ylmethyl)-1-methoxypentan-2-amine.
| Compound Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-1-methoxypentan-2-amine |
|---|---|
| PubChem CID | 80649718 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-1-methoxypentan-2-amine |
| SMILES | CCCC(COC)NCc1cccc2c1NCC2 |
| InChI | InChI=1S/C15H24N2O/c1-3-5-14(11-18-2)17-10-13-7-4-6-12-8-9-16-15(12)13/h4,6-7,14,16-17H,3,5,8-11H2,1-2H3 |
| InChIKey | YJPRIPXTPZZYIH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |