About 5-acetyl-1-[(3,4-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione
5-acetyl-1-[(3,4-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione (PubChem CID 80650254) has the molecular formula C16H18N2O3
and a molecular weight of 286.33 g/mol. Its IUPAC name is 5-acetyl-1-[(3,4-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-acetyl-1-[(3,4-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione |
| PubChem CID | 80650254 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 5-acetyl-1-[(3,4-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione |
| SMILES | CC(=O)c1cn(Cc2ccc(C)c(C)c2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H18N2O3/c1-10-5-6-13(7-11(10)2)8-18-9-14(12(3)19)15(20)17(4)16(18)21/h5-7,9H,8H2,1-4H3 |
| InChIKey | WJNRSSBZGCVVPN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-acetyl-1-[(3,4-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-1-[(3,4-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione?
The IUPAC name of 5-acetyl-1-[(3,4-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione (CID 80650254) is 5-acetyl-1-[(3,4-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione.
What is the SMILES notation for 5-acetyl-1-[(3,4-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione?
The canonical SMILES for 5-acetyl-1-[(3,4-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione is CC(=O)c1cn(Cc2ccc(C)c(C)c2)c(=O)n(C)c1=O.
What is the InChIKey of 5-acetyl-1-[(3,4-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione?
The InChIKey is WJNRSSBZGCVVPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3/c1-10-5-6-13(7-11(10)2)8-18-9-14(12(3)19)15(20)17(4)16(18)21/h5-7,9H,8H2,1-4H3.
What are the key properties of 5-acetyl-1-[(3,4-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione?
5-acetyl-1-[(3,4-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione has a molecular weight of 286.33 g/mol, XLogP of 1.41, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-1-[(3,4-dimethylphenyl)methyl]-3-methylpyrimidine-2,4-dione is sourced from PubChem (CID 80650254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).