About 2-[[5-(aminomethyl)-3-methyl-2-pyridinyl]sulfanyl]-N,N-dimethylethanamine
2-[[5-(aminomethyl)-3-methyl-2-pyridinyl]sulfanyl]-N,N-dimethylethanamine (PubChem CID 80651106) has the molecular formula C11H19N3S
and a molecular weight of 225.36 g/mol. Its IUPAC name is 2-[[5-(aminomethyl)-3-methyl-2-pyridinyl]sulfanyl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[[5-(aminomethyl)-3-methyl-2-pyridinyl]sulfanyl]-N,N-dimethylethanamine |
| PubChem CID | 80651106 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-[[5-(aminomethyl)-3-methyl-2-pyridinyl]sulfanyl]-N,N-dimethylethanamine |
| SMILES | Cc1cc(CN)cnc1SCCN(C)C |
| InChI | InChI=1S/C11H19N3S/c1-9-6-10(7-12)8-13-11(9)15-5-4-14(2)3/h6,8H,4-5,7,12H2,1-3H3 |
| InChIKey | MYBBAMZXQZKPQT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[5-(aminomethyl)-3-methyl-2-pyridinyl]sulfanyl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(aminomethyl)-3-methyl-2-pyridinyl]sulfanyl]-N,N-dimethylethanamine?
The IUPAC name of 2-[[5-(aminomethyl)-3-methyl-2-pyridinyl]sulfanyl]-N,N-dimethylethanamine (CID 80651106) is 2-[[5-(aminomethyl)-3-methyl-2-pyridinyl]sulfanyl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[[5-(aminomethyl)-3-methyl-2-pyridinyl]sulfanyl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[[5-(aminomethyl)-3-methyl-2-pyridinyl]sulfanyl]-N,N-dimethylethanamine is Cc1cc(CN)cnc1SCCN(C)C.
What is the InChIKey of 2-[[5-(aminomethyl)-3-methyl-2-pyridinyl]sulfanyl]-N,N-dimethylethanamine?
The InChIKey is MYBBAMZXQZKPQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3S/c1-9-6-10(7-12)8-13-11(9)15-5-4-14(2)3/h6,8H,4-5,7,12H2,1-3H3.
What are the key properties of 2-[[5-(aminomethyl)-3-methyl-2-pyridinyl]sulfanyl]-N,N-dimethylethanamine?
2-[[5-(aminomethyl)-3-methyl-2-pyridinyl]sulfanyl]-N,N-dimethylethanamine has a molecular weight of 225.36 g/mol, XLogP of 1.50, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(aminomethyl)-3-methyl-2-pyridinyl]sulfanyl]-N,N-dimethylethanamine is sourced from PubChem (CID 80651106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).