About [6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanol
[6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanol (PubChem CID 80651278) has the molecular formula C10H10N2OS2
and a molecular weight of 238.34 g/mol. Its IUPAC name is [6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanol |
| PubChem CID | 80651278 |
| Molecular Formula | C10H10N2OS2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | [6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanol |
| SMILES | Cc1csc(Sc2ccc(CO)cn2)n1 |
| InChI | InChI=1S/C10H10N2OS2/c1-7-6-14-10(12-7)15-9-3-2-8(5-13)4-11-9/h2-4,6,13H,5H2,1H3 |
| InChIKey | NITSYJMWILBWHH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanol?
The IUPAC name of [6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanol (CID 80651278) is [6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanol.
What is the SMILES notation for [6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanol?
The canonical SMILES for [6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanol is Cc1csc(Sc2ccc(CO)cn2)n1.
What is the InChIKey of [6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanol?
The InChIKey is NITSYJMWILBWHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2OS2/c1-7-6-14-10(12-7)15-9-3-2-8(5-13)4-11-9/h2-4,6,13H,5H2,1H3.
What are the key properties of [6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanol?
[6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanol has a molecular weight of 238.34 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-pyridinyl]methanol is sourced from PubChem (CID 80651278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).