About 3-[[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]sulfanyl]propane-1,2-diol
3-[[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]sulfanyl]propane-1,2-diol (PubChem CID 80651518) has the molecular formula C13H22N2O2S
and a molecular weight of 270.40 g/mol. Its IUPAC name is 3-[[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]sulfanyl]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]sulfanyl]propane-1,2-diol |
| PubChem CID | 80651518 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 3-[[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]sulfanyl]propane-1,2-diol |
| SMILES | Cc1cc(CNC(C)C)cnc1SCC(O)CO |
| InChI | InChI=1S/C13H22N2O2S/c1-9(2)14-5-11-4-10(3)13(15-6-11)18-8-12(17)7-16/h4,6,9,12,14,16-17H,5,7-8H2,1-3H3 |
| InChIKey | OCVBLLMYEGXSDK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]sulfanyl]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]sulfanyl]propane-1,2-diol?
The IUPAC name of 3-[[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]sulfanyl]propane-1,2-diol (CID 80651518) is 3-[[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]sulfanyl]propane-1,2-diol.
What is the SMILES notation for 3-[[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]sulfanyl]propane-1,2-diol?
The canonical SMILES for 3-[[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]sulfanyl]propane-1,2-diol is Cc1cc(CNC(C)C)cnc1SCC(O)CO.
What is the InChIKey of 3-[[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]sulfanyl]propane-1,2-diol?
The InChIKey is OCVBLLMYEGXSDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O2S/c1-9(2)14-5-11-4-10(3)13(15-6-11)18-8-12(17)7-16/h4,6,9,12,14,16-17H,5,7-8H2,1-3H3.
What are the key properties of 3-[[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]sulfanyl]propane-1,2-diol?
3-[[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]sulfanyl]propane-1,2-diol has a molecular weight of 270.40 g/mol, XLogP of 1.33, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-methyl-5-[(propan-2-ylamino)methyl]-2-pyridinyl]sulfanyl]propane-1,2-diol is sourced from PubChem (CID 80651518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).