About 2-N-methyl-2-N-phenylpyrazine-2,5-diamine
2-N-methyl-2-N-phenylpyrazine-2,5-diamine (PubChem CID 80652366) has the molecular formula C11H12N4
and a molecular weight of 200.25 g/mol. Its IUPAC name is 2-N-methyl-2-N-phenylpyrazine-2,5-diamine.
Molecular Properties
| Compound Name | 2-N-methyl-2-N-phenylpyrazine-2,5-diamine |
| PubChem CID | 80652366 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 2-N-methyl-2-N-phenylpyrazine-2,5-diamine |
| SMILES | CN(c1ccccc1)c1cnc(N)cn1 |
| InChI | InChI=1S/C11H12N4/c1-15(9-5-3-2-4-6-9)11-8-13-10(12)7-14-11/h2-8H,1H3,(H2,12,13) |
| InChIKey | DVIJMJHFJYTCRB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-methyl-2-N-phenylpyrazine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-methyl-2-N-phenylpyrazine-2,5-diamine?
The IUPAC name of 2-N-methyl-2-N-phenylpyrazine-2,5-diamine (CID 80652366) is 2-N-methyl-2-N-phenylpyrazine-2,5-diamine.
What is the SMILES notation for 2-N-methyl-2-N-phenylpyrazine-2,5-diamine?
The canonical SMILES for 2-N-methyl-2-N-phenylpyrazine-2,5-diamine is CN(c1ccccc1)c1cnc(N)cn1.
What is the InChIKey of 2-N-methyl-2-N-phenylpyrazine-2,5-diamine?
The InChIKey is DVIJMJHFJYTCRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4/c1-15(9-5-3-2-4-6-9)11-8-13-10(12)7-14-11/h2-8H,1H3,(H2,12,13).
What are the key properties of 2-N-methyl-2-N-phenylpyrazine-2,5-diamine?
2-N-methyl-2-N-phenylpyrazine-2,5-diamine has a molecular weight of 200.25 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-methyl-2-N-phenylpyrazine-2,5-diamine is sourced from PubChem (CID 80652366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).