C8H14N4O — CID 80652394
1-[(5-aminopyrazin-2-yl)-methylamino]propan-2-ol (PubChem CID 80652394) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 1-[(5-aminopyrazin-2-yl)-methylamino]propan-2-ol.
| Compound Name | 1-[(5-aminopyrazin-2-yl)-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 80652394 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 1-[(5-aminopyrazin-2-yl)-methylamino]propan-2-ol |
| SMILES | CC(O)CN(C)c1cnc(N)cn1 |
| InChI | InChI=1S/C8H14N4O/c1-6(13)5-12(2)8-4-10-7(9)3-11-8/h3-4,6,13H,5H2,1-2H3,(H2,9,10) |
| InChIKey | OFPYBOGUKVBDDT-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |